Compound Q&A

What industries use 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

Answer

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione
1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) finds applications in the pharmaceutical industry for the synthesis of certain drugs, as well as in the development of sensors and semiconductors. Its unique properties make it useful in polymer research for creating functional materials and in the electronics industry for developing novel materials with specific electrical properties.

About

CAS No 65833-01-4
English Name 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione
Molecular Formula C10H6INO2
Molecular Weight 299.06700000000006 g/mol
SMILES Ic1ccc(cc1)N2C(=O)C=CC2=O
InChIKey GIXQASIEVHMYQH-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) is a crystalline solid with a molecular weig...

Compound Q&A

How is 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) typically synthesized?

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione is synthesized via the iodination of 1H-pyrrole-2,5-dione foll...

Compound Q&A

What precautions should be taken when handling 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

When handling 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4), it is crucial to wear appropr...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...