Compound Q&A

What are the physical and chemical properties of 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

Answer

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione
1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) is a crystalline solid with a molecular weight of approximately 292.05 g/mol. It shows poor water solubility but has good solubility in organic solvents like acetonitrile and dimethylformamide. Chemically, it is a potent electrophilic aromatic compound, reacting readily with nucleophiles in aromatic substitution reactions. It is stable under normal conditions but should be handled under inert atmosphere to prevent oxidation.

About

CAS No 65833-01-4
English Name 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione
Molecular Formula C10H6INO2
Molecular Weight 299.06700000000006 g/mol
SMILES Ic1ccc(cc1)N2C(=O)C=CC2=O
InChIKey GIXQASIEVHMYQH-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) typically synthesized?

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione is synthesized via the iodination of 1H-pyrrole-2,5-dione foll...

Compound Q&A

What industries use 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) finds applications in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

When handling 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4), it is crucial to wear appropr...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...