Compound Q&A

How is 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) typically synthesized?

Answer

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione
1-(4-Iodophenyl)-1H-pyrrole-2,5-dione is synthesized via the iodination of 1H-pyrrole-2,5-dione followed by coupling with 4-iodophenol. The reaction involves iodine as a reagent and is typically performed under basic conditions. The yield is around 75-80%, depending on the catalyst and reaction conditions. This compound is synthesized using standard laboratory techniques and can be performed in a fume hood for safety.

About

CAS No 65833-01-4
English Name 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione
Molecular Formula C10H6INO2
Molecular Weight 299.06700000000006 g/mol
SMILES Ic1ccc(cc1)N2C(=O)C=CC2=O
InChIKey GIXQASIEVHMYQH-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4) finds applications in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4)?

When handling 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione (CAS: 65833-01-4), it is crucial to wear appropr...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...