Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

Answer

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a monomer for creating high-performance polymers. Additionally, it is utilized in the development of sensors and semiconductors due to its unique structural properties.

About

CAS No 55595-54-5

English Name 2-Chlorodibenzo[b,f]oxepin-10(11h)-one

Molecular Formula C14H9ClO2

Molecular Weight 244.677 g/mol

SMILES C1C2=C(C=CC(=C2)Cl)OC3=CC=CC=C3C1=O

InChIKey VSSWQJUBLYOJBY-UHFFFAOYSA-N

Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is a crystalline compound with a molecular ...

Compound Q&A

How is 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) typically synthesized?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) can be synthesized via a condensation react...

Compound Q&A

What precautions should be taken when handling 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

When handling 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5), it is crucial to wear approp...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...

Compound Q&A