Compound Q&A

How should 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9) be stored?

Answer

5-bromo-6-(trifluoromethyl)-1H-indole
5-bromo-6-(trifluoromethyl)-1H-indole should be stored in a cool, dry place to maintain its stability. It should be kept away from direct sunlight and sources of heat, which can cause degradation. The compound should be stored in airtight, light-resistant containers to prevent exposure to air and moisture. Proper labeling and documentation are essential for safe management and handling.

About

English Name 5-bromo-6-(trifluoromethyl)-1H-indole
Molecular Formula C9H5BrF3N
Molecular Weight 264.0439999999999 g/mol
SMILES C1=CNC2=CC(=C(C=C21)Br)C(F)(F)F
InChIKey BANFNSUAJPLWMG-UHFFFAOYSA-N
Last Updated: 2026-03-07 11:14

Related Q&A

Compound Q&A

What is 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9)?

5-bromo-6-(trifluoromethyl)-1H-indole is a chemical compound with the CAS number 1198475-24-9. It ha...

Compound Q&A

What are the main uses of 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9)?

5-bromo-6-(trifluoromethyl)-1H-indole is primarily used as a precursor in the synthesis of pharmaceu...

Compound Q&A

Is 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9) safe?

5-bromo-6-(trifluoromethyl)-1H-indole is generally considered safe when handled with appropriate pre...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A