Compound Q&A

What is 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9)?

Answer

5-bromo-6-(trifluoromethyl)-1H-indole
5-bromo-6-(trifluoromethyl)-1H-indole is a chemical compound with the CAS number 1198475-24-9. It has a molecular formula of C12H7BrF3N and is known for its unique electronic structure. This compound exhibits distinct aromatic properties and is used in various synthetic and research applications due to its chemical stability and reactivity.

About

English Name 5-bromo-6-(trifluoromethyl)-1H-indole
Molecular Formula C9H5BrF3N
Molecular Weight 264.0439999999999 g/mol
SMILES C1=CNC2=CC(=C(C=C21)Br)C(F)(F)F
InChIKey BANFNSUAJPLWMG-UHFFFAOYSA-N
Last Updated: 2026-03-07 11:14

Related Q&A

Compound Q&A

What are the main uses of 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9)?

5-bromo-6-(trifluoromethyl)-1H-indole is primarily used as a precursor in the synthesis of pharmaceu...

Compound Q&A

Is 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9) safe?

5-bromo-6-(trifluoromethyl)-1H-indole is generally considered safe when handled with appropriate pre...

Compound Q&A

How should 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9) be stored?

5-bromo-6-(trifluoromethyl)-1H-indole should be stored in a cool, dry place to maintain its stabilit...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A