Compound Q&A

Is 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9) safe?

Answer

5-bromo-6-(trifluoromethyl)-1H-indole
5-bromo-6-(trifluoromethyl)-1H-indole is generally considered safe when handled with appropriate precautions. However, it is important to follow safety guidelines, including proper ventilation and the use of personal protective equipment (PPE) such as gloves and goggles. Direct contact with skin or eyes should be avoided, and the compound should be stored in a cool, dry place away from heat sources and oxidizers.

About

English Name 5-bromo-6-(trifluoromethyl)-1H-indole
Molecular Formula C9H5BrF3N
Molecular Weight 264.0439999999999 g/mol
SMILES C1=CNC2=CC(=C(C=C21)Br)C(F)(F)F
InChIKey BANFNSUAJPLWMG-UHFFFAOYSA-N
Last Updated: 2026-03-07 11:14

Related Q&A

Compound Q&A

What is 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9)?

5-bromo-6-(trifluoromethyl)-1H-indole is a chemical compound with the CAS number 1198475-24-9. It ha...

Compound Q&A

What are the main uses of 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9)?

5-bromo-6-(trifluoromethyl)-1H-indole is primarily used as a precursor in the synthesis of pharmaceu...

Compound Q&A

How should 5-bromo-6-(trifluoromethyl)-1H-indole (CAS: 1198475-24-9) be stored?

5-bromo-6-(trifluoromethyl)-1H-indole should be stored in a cool, dry place to maintain its stabilit...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A