Compound Q&A

How should Brevetoxin B (CAS: 79580-28-2) be stored?

Answer

Brevetoxin B
Brevetoxin B (CAS: 79580-28-2) should be stored in a cool, dry place away from direct sunlight and heat sources to maintain its stability. It should be kept in a tightly sealed container and stored at a temperature between 2°C and 8°C (36°F to 46°F) to prevent degradation. Adequate ventilation should be provided to avoid the risk of inhalation exposure.

About

CAS No 79580-28-2
English Name Brevetoxin B
Molecular Formula C50H70O14
Molecular Weight 895.1 g/mol
SMILES CC1CC2C(CC3(C(O2)CC4C(O3)C(=CC(=O)O4)C)C)OC5C1OC6CC7C(CC8C(O7)(CC=CC9C(O8)CC1C(O9)CC2C(O1)(C(CC(O2)CC(=C)C=O)O)C)C)(OC6(CC5)C)C
InChIKey LYTCVQQGCSNFJU-FGRVLNGBSA-N
Last Updated: 2026-03-07 00:00

Related Q&A

Compound Q&A

What is Brevetoxin B (CAS: 79580-28-2)?

Brevetoxin B (CAS: 79580-28-2) is a marine toxin produced by certain species of dinoflagellates, par...

Compound Q&A

What are the main uses of Brevetoxin B (CAS: 79580-28-2)?

Brevetoxin B (CAS: 79580-28-2) is primarily used in research to study the mechanisms of neurotoxic e...

Compound Q&A

Is Brevetoxin B (CAS: 79580-28-2) safe?

Brevetoxin B (CAS: 79580-28-2) is not considered safe for human consumption and should be handled wi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...