Compound Q&A

What are the main uses of Brevetoxin B (CAS: 79580-28-2)?

Answer

Brevetoxin B
Brevetoxin B (CAS: 79580-28-2) is primarily used in research to study the mechanisms of neurotoxic effects and to develop treatments for neurodegenerative diseases. It is also of interest in toxicology and marine biology for understanding the impacts of harmful algal blooms on marine ecosystems.

About

CAS No 79580-28-2
English Name Brevetoxin B
Molecular Formula C50H70O14
Molecular Weight 895.1 g/mol
SMILES CC1CC2C(CC3(C(O2)CC4C(O3)C(=CC(=O)O4)C)C)OC5C1OC6CC7C(CC8C(O7)(CC=CC9C(O8)CC1C(O9)CC2C(O1)(C(CC(O2)CC(=C)C=O)O)C)C)(OC6(CC5)C)C
InChIKey LYTCVQQGCSNFJU-FGRVLNGBSA-N
Last Updated: 2026-03-07 00:00

Related Q&A

Compound Q&A

What is Brevetoxin B (CAS: 79580-28-2)?

Brevetoxin B (CAS: 79580-28-2) is a marine toxin produced by certain species of dinoflagellates, par...

Compound Q&A

Is Brevetoxin B (CAS: 79580-28-2) safe?

Brevetoxin B (CAS: 79580-28-2) is not considered safe for human consumption and should be handled wi...

Compound Q&A

How should Brevetoxin B (CAS: 79580-28-2) be stored?

Brevetoxin B (CAS: 79580-28-2) should be stored in a cool, dry place away from direct sunlight and h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...