Compound Q&A

Is Brevetoxin B (CAS: 79580-28-2) safe?

Answer

Brevetoxin B
Brevetoxin B (CAS: 79580-28-2) is not considered safe for human consumption and should be handled with caution due to its potent neurotoxic properties. Proper protective measures, such as gloves and lab coats, should be used when handling this compound. It is important to store it under secure conditions to prevent accidental exposure.

About

CAS No 79580-28-2
English Name Brevetoxin B
Molecular Formula C50H70O14
Molecular Weight 895.1 g/mol
SMILES CC1CC2C(CC3(C(O2)CC4C(O3)C(=CC(=O)O4)C)C)OC5C1OC6CC7C(CC8C(O7)(CC=CC9C(O8)CC1C(O9)CC2C(O1)(C(CC(O2)CC(=C)C=O)O)C)C)(OC6(CC5)C)C
InChIKey LYTCVQQGCSNFJU-FGRVLNGBSA-N
Last Updated: 2026-03-07 00:00

Related Q&A

Compound Q&A

What is Brevetoxin B (CAS: 79580-28-2)?

Brevetoxin B (CAS: 79580-28-2) is a marine toxin produced by certain species of dinoflagellates, par...

Compound Q&A

What are the main uses of Brevetoxin B (CAS: 79580-28-2)?

Brevetoxin B (CAS: 79580-28-2) is primarily used in research to study the mechanisms of neurotoxic e...

Compound Q&A

How should Brevetoxin B (CAS: 79580-28-2) be stored?

Brevetoxin B (CAS: 79580-28-2) should be stored in a cool, dry place away from direct sunlight and h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...