Compound Q&A

How is Z-Gly-gln-OH (CAS: 6154-39-8) typically synthesized?

Answer

Z-Gly-gln-OH
Z-Gly-gln-OH (CAS: 6154-39-8) can be synthesized via solid-phase peptide synthesis methods. The key steps involve coupling glycine (Gly) and glutamine (Gln) amino acids using appropriate coupling reagents and protecting groups. The coupling is typically carried out in an organic solvent such as dichloromethane (DCM) and catalyzed by a carbodiimide like N,N'-dicyclohexylcarbodiimide (DCC). The final step involves deprotection and cleavage from the resin support.

About

CAS No 6154-39-8
English Name Z-Gly-gln-OH
Molecular Formula C15H19N3O6
Molecular Weight 337.33 g/mol
SMILES C1=CC=C(C=C1)COC(=O)NCC(=O)NC(CCC(=O)N)C(=O)O
InChIKey BYMPQNRKDGXXFG-NSHDSACASA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Z-Gly-gln-OH (CAS: 6154-39-8)?

Z-Gly-gln-OH (CAS: 6154-39-8) is a crystalline compound with a molecular weight of approximately 268...

Compound Q&A

What industries use Z-Gly-gln-OH (CAS: 6154-39-8)?

Z-Gly-gln-OH (CAS: 6154-39-8) is primarily used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling Z-Gly-gln-OH (CAS: 6154-39-8)?

When handling Z-Gly-gln-OH (CAS: 6154-39-8), proper personal protective equipment (PPE) should be wo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...