Compound Q&A

What precautions should be taken when handling tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

Answer

tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate
When handling tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9), it is essential to follow safety guidelines closely. Use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to prevent inhalation. Store the compound in a cool, dry place away from direct sunlight and heat sources. In the case of spills, immediately clean up using appropriate materials and refer to the Safety Data Sheet (SDS) for further instructions.

About

English Name tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate
Molecular Formula C11H23NO3
Molecular Weight 217.31 g/mol
SMILES CC(C)N(CCCO)C(=O)OC(C)(C)C
InChIKey LLCYWHXMBXMVAS-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) is a white crystalline solid with a...

Compound Q&A

How is tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) typically synthesized?

t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) can be synthesized via a multi-step...

Compound Q&A

What industries use tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) is primarily used in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...