Compound Q&A

How is tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) typically synthesized?

Answer

tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate
t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) can be synthesized via a multi-step reaction involving the formation of an intermediate amide, followed by alkylation of the hydroxy group. The synthesis typically uses tert-butanol, 3-hydroxypropyl isopropylamine, and a suitable base like triethylamine as a catalyst. The process yields a high purity product with good selectivity and high yield, making it suitable for industrial applications.

About

English Name tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate
Molecular Formula C11H23NO3
Molecular Weight 217.31 g/mol
SMILES CC(C)N(CCCO)C(=O)OC(C)(C)C
InChIKey LLCYWHXMBXMVAS-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) is a white crystalline solid with a...

Compound Q&A

What industries use tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

When handling tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...