Compound Q&A

What are the physical and chemical properties of tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

Answer

tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate
t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) is a white crystalline solid with a molecular weight of approximately 242.29 g/mol. It is slightly soluble in water but miscible with organic solvents like ethanol and acetone. The compound is known for its reactivity, particularly in nucleophilic substitution reactions. It can form stable complexes with various reagents and is often used in organic synthesis due to its unique reactivity.

About

English Name tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate
Molecular Formula C11H23NO3
Molecular Weight 217.31 g/mol
SMILES CC(C)N(CCCO)C(=O)OC(C)(C)C
InChIKey LLCYWHXMBXMVAS-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

How is tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) typically synthesized?

t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) can be synthesized via a multi-step...

Compound Q&A

What industries use tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

t-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9)?

When handling tert-Butyl (3-hydroxypropyl)(isopropyl)carbamate (CAS: 873437-13-9), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...