Compound Q&A

What industries use 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

Answer

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid
1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is used in the pharmaceutical industry for the synthesis of various drugs due to its unique chemical structure. It also finds applications in the polymer industry for the development of advanced materials. Additionally, it is utilized in the semiconductor and sensor industries for its specific functional properties.

About

English Name 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid
Molecular Formula C13H16FNO2
Molecular Weight 237.27 g/mol
SMILES C1CC(CN(C1)CC2=CC=CC=C2F)C(=O)O
InChIKey KOXCBDNTCRUQDS-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4) typically synthesized?

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is typically synthesized via the coupling of 2-fluoro...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

When handling 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...