Compound Q&A

What are the physical and chemical properties of 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

Answer

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid
1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is a crystalline solid with a molecular weight of approximately 272.22 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. The compound exhibits good stability under normal conditions but shows reactivity towards bases and reducing agents.

About

English Name 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid
Molecular Formula C13H16FNO2
Molecular Weight 237.27 g/mol
SMILES C1CC(CN(C1)CC2=CC=CC=C2F)C(=O)O
InChIKey KOXCBDNTCRUQDS-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4) typically synthesized?

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is typically synthesized via the coupling of 2-fluoro...

Compound Q&A

What industries use 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

When handling 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...