Compound Q&A

How is 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4) typically synthesized?

Answer

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid
1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is typically synthesized via the coupling of 2-fluorobenzyl chloride with 3-piperidinemethanol. The reaction is catalyzed by a suitable base like triethylamine and proceeds with good yield. The purity can be ensured by recrystallization from an appropriate solvent.

About

English Name 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid
Molecular Formula C13H16FNO2
Molecular Weight 237.27 g/mol
SMILES C1CC(CN(C1)CC2=CC=CC=C2F)C(=O)O
InChIKey KOXCBDNTCRUQDS-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-65-4)?

When handling 1-(2-Fluorobenzyl)-3-piperidinecarboxylic acid, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...