Compound Q&A

What precautions should be taken when handling Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

Answer

Ethyl (3,4-difluorophenyl)(oxo)acetate
When handling Ethyl (3,4-difluorophenyl)(oxo)acetate, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Proper spill handling procedures should be in place, and the material safety data sheet (SDS) should be consulted for detailed safety information.

About

CAS No 73790-05-3
English Name Ethyl (3,4-difluorophenyl)(oxo)acetate
Molecular Formula C10H8F2O3
Molecular Weight 214.17 g/mol
SMILES CCOC(=O)C(=O)C1=CC(=C(C=C1)F)F
InChIKey DYIBSNLBZKOXNA-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

Ethyl (3,4-difluorophenyl)(oxo)acetate is a crystalline compound with a high molecular weight. It ex...

Compound Q&A

How is Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3) typically synthesized?

Ethyl (3,4-difluorophenyl)(oxo)acetate is synthesized through the reaction of ethyl acetoacetate wit...

Compound Q&A

What industries use Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

Ethyl (3,4-difluorophenyl)(oxo)acetate is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...