Compound Q&A

How is Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3) typically synthesized?

Answer

Ethyl (3,4-difluorophenyl)(oxo)acetate
Ethyl (3,4-difluorophenyl)(oxo)acetate is synthesized through the reaction of ethyl acetoacetate with 3,4-difluorophenyl isocyanate in the presence of a suitable catalyst such as triethylamine. The process involves careful control of temperature and reaction time to achieve high yield and selectivity.

About

CAS No 73790-05-3
English Name Ethyl (3,4-difluorophenyl)(oxo)acetate
Molecular Formula C10H8F2O3
Molecular Weight 214.17 g/mol
SMILES CCOC(=O)C(=O)C1=CC(=C(C=C1)F)F
InChIKey DYIBSNLBZKOXNA-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

Ethyl (3,4-difluorophenyl)(oxo)acetate is a crystalline compound with a high molecular weight. It ex...

Compound Q&A

What industries use Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

Ethyl (3,4-difluorophenyl)(oxo)acetate is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

When handling Ethyl (3,4-difluorophenyl)(oxo)acetate, it is essential to use personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...