Compound Q&A

What are the physical and chemical properties of Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

Answer

Ethyl (3,4-difluorophenyl)(oxo)acetate
Ethyl (3,4-difluorophenyl)(oxo)acetate is a crystalline compound with a high molecular weight. It exhibits low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is known for its moderate reactivity, particularly towards nucleophiles and reducing agents. It has a distinctive melting point and is stable under normal conditions.

About

CAS No 73790-05-3
English Name Ethyl (3,4-difluorophenyl)(oxo)acetate
Molecular Formula C10H8F2O3
Molecular Weight 214.17 g/mol
SMILES CCOC(=O)C(=O)C1=CC(=C(C=C1)F)F
InChIKey DYIBSNLBZKOXNA-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3) typically synthesized?

Ethyl (3,4-difluorophenyl)(oxo)acetate is synthesized through the reaction of ethyl acetoacetate wit...

Compound Q&A

What industries use Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

Ethyl (3,4-difluorophenyl)(oxo)acetate is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling Ethyl (3,4-difluorophenyl)(oxo)acetate (CAS: 73790-05-3)?

When handling Ethyl (3,4-difluorophenyl)(oxo)acetate, it is essential to use personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...