Compound Q&A

What industries use (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5)?

Answer

(2R)-2-(4-Hydroxyphenyl)propanoic acid
(2R)-2-(4-Hydroxyphenyl)propanoic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It also finds applications in the production of fragrances and flavor compounds, as well as in the development of some food additives. Its use in polymers and sensors is also being explored, though on a smaller scale.

About

CAS No 59092-88-5
English Name (2R)-2-(4-Hydroxyphenyl)propanoic acid
Molecular Formula C9H10O3
Molecular Weight 166.18 g/mol
SMILES C[C@H](c1ccc(cc1)O)C(=O)O
InChIKey ZHMMPVANGNPCBW-ZCFIWIBFSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5)?

(2R)-2-(4-Hydroxyphenyl)propanoic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5) typically synthesized?

(2R)-2-(4-Hydroxyphenyl)propanoic acid can be synthesized through the reduction of 2-phenylpropanoyl...

Compound Q&A

What precautions should be taken when handling (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5)?

When handling (2R)-2-(4-Hydroxyphenyl)propanoic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...