Compound Q&A

What are the physical and chemical properties of (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5)?

Answer

(2R)-2-(4-Hydroxyphenyl)propanoic acid
(2R)-2-(4-Hydroxyphenyl)propanoic acid is a white crystalline solid with a molecular weight of approximately 188.18 g/mol. It is slightly soluble in water and more soluble in solvents like ethanol and methanol. Chemically, it is moderately reactive, particularly with bases and reducing agents, making it useful in various chemical reactions. It has a pKa of about 3.5, indicating its acidic nature.

About

CAS No 59092-88-5
English Name (2R)-2-(4-Hydroxyphenyl)propanoic acid
Molecular Formula C9H10O3
Molecular Weight 166.18 g/mol
SMILES C[C@H](c1ccc(cc1)O)C(=O)O
InChIKey ZHMMPVANGNPCBW-ZCFIWIBFSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5) typically synthesized?

(2R)-2-(4-Hydroxyphenyl)propanoic acid can be synthesized through the reduction of 2-phenylpropanoyl...

Compound Q&A

What industries use (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5)?

(2R)-2-(4-Hydroxyphenyl)propanoic acid is primarily used in the pharmaceutical industry as an interm...

Compound Q&A

What precautions should be taken when handling (2R)-2-(4-Hydroxyphenyl)propanoic acid (CAS: 59092-88-5)?

When handling (2R)-2-(4-Hydroxyphenyl)propanoic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...