Compound Q&A

How is 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) typically synthesized?

Answer

2-(Benzyloxy)-6-fluorobenzonitrile
2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) is typically synthesized via a multistep process involving the use of fluorine-containing reagents and benzyl alcohol. The reaction involves the nucleophilic substitution of a fluorine atom onto a benzene ring followed by the introduction of a benzyloxy group. Commonly, this is achieved using potassium fluoride and benzyl alcohol in the presence of a catalyst such as a Lewis acid or a base. The reaction is highly selective and provides good yields.

About

CAS No 94088-45-6
English Name 2-(Benzyloxy)-6-fluorobenzonitrile
Molecular Formula C14H10FNO
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C=C1)COC2=C(C(=CC=C2)F)C#N
InChIKey ITKHCBLEEGSDOF-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6)?

2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) is a crystalline solid with a molecular weight ...

Compound Q&A

What industries use 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6)?

2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) is used in various industries, particularly in ...

Compound Q&A

What precautions should be taken when handling 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6)?

When handling 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...