Compound Q&A

What are the physical and chemical properties of 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6)?

Answer

2-(Benzyloxy)-6-fluorobenzonitrile
2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) is a crystalline solid with a molecular weight of approximately 227.18 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and ethanol. Chemically, it is reactive and can undergo nucleophilic substitution reactions. It does not readily decompose under normal conditions but should be stored in a cool, dry place to prevent potential hydrolysis.

About

CAS No 94088-45-6
English Name 2-(Benzyloxy)-6-fluorobenzonitrile
Molecular Formula C14H10FNO
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C=C1)COC2=C(C(=CC=C2)F)C#N
InChIKey ITKHCBLEEGSDOF-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) typically synthesized?

2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) is typically synthesized via a multistep proces...

Compound Q&A

What industries use 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6)?

2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6) is used in various industries, particularly in ...

Compound Q&A

What precautions should be taken when handling 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6)?

When handling 2-(Benzyloxy)-6-fluorobenzonitrile (CAS: 94088-45-6), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...