Compound Q&A

What industries use 2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2)?

Answer

2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine
2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine is primarily used in the pharmaceutical industry as a structural building block for the synthesis of peptidomimetic drugs. It is also used in the polymer industry for the development of biocompatible polymers and in the sensor industry for the fabrication of biosensors. Its use in semiconductor applications is limited due to its non-conductive nature.

About

English Name 2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine
Molecular Formula C15H20N2O5
Molecular Weight 308.33 g/mol
SMILES O=C(OC(C)(C)C)N[C@@H](C(=O)O)Cc1ccccc1C(=O)N
InChIKey FMPVOXUPJFIODB-LLVKDONJSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2)?

2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine is a crystalline compound with a ...

Compound Q&A

How is 2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2) typically synthesized?

2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine is usually synthesized by the con...

Compound Q&A

What precautions should be taken when handling 2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2)?

When handling 2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine, safety gloves and g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...