Compound Q&A

What are the physical and chemical properties of 2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2)?

Answer

2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine
2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine is a crystalline compound with a molecular weight of approximately 344.35 g/mol. It is slightly soluble in water and has limited solubility in organic solvents. The compound is reactive towards nucleophiles and can undergo hydrolysis under basic conditions. It crystallizes in the orthorhombic system with a melting point around 220°C.

About

English Name 2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine
Molecular Formula C15H20N2O5
Molecular Weight 308.33 g/mol
SMILES O=C(OC(C)(C)C)N[C@@H](C(=O)O)Cc1ccccc1C(=O)N
InChIKey FMPVOXUPJFIODB-LLVKDONJSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2) typically synthesized?

2-Carbamoyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine is usually synthesized by the con...

Compound Q&A

What industries use 2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2)?

2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine (CAS: 1213116-63-2)?

When handling 2-Carbamoyl-N-{[(2-methyl-2-proanyl)oxy]carbonyl}-D-phenylalanine, safety gloves and g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...