Compound Q&A

What industries use 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4)?

Answer

7-Bromoquinoline-3-carbaldehyde
7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various drugs and organic compounds. Additionally, it finds applications in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name 7-Bromoquinoline-3-carbaldehyde
Molecular Formula C10H6BrNO
Molecular Weight 236.06799999999998 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C=O)Br
InChIKey XQKNZUWXMUYLKO-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4)?

7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) typically synthesized?

7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) is typically synthesized through the bromination ...

Compound Q&A

What precautions should be taken when handling 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4)?

When handling 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4), it is essential to wear appropriat...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...