Compound Q&A

What are the physical and chemical properties of 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4)?

Answer

7-Bromoquinoline-3-carbaldehyde
7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) is a crystalline solid with a molecular weight of approximately 235.06 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is known for its high reactivity, particularly towards nucleophiles due to the presence of the carbonyl group and the electron-withdrawing bromine atom. It is often used in organic synthesis as a key intermediate.

About

English Name 7-Bromoquinoline-3-carbaldehyde
Molecular Formula C10H6BrNO
Molecular Weight 236.07 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C=O)Br
InChIKey XQKNZUWXMUYLKO-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) typically synthesized?

7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) is typically synthesized through the bromination ...

Compound Q&A

What industries use 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4)?

7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4) is primarily used in the pharmaceutical and chemi...

Compound Q&A

What precautions should be taken when handling 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4)?

When handling 7-Bromoquinoline-3-carbaldehyde (CAS: 745830-24-4), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...