Compound Q&A

How is (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0) typically synthesized?

Answer

(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid
(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid can be synthesized through the coupling of 7-methyl-2-oxo-2H-chromen-4-yl chloride with acetic acid using a suitable base such as sodium hydride. The reaction is typically carried out in an inert solvent like THF at room temperature. High yields and good selectivity can be achieved under these conditions.

About

CAS No 50402-83-0
English Name (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid
Molecular Formula C12H10O4
Molecular Weight 218.21 g/mol
SMILES CC1=CC2=C(C=C1)C(=CC(=O)O2)CC(=O)O
InChIKey VDQLZKYCWITDPF-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0)?

(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0)?

(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0)?

When handling (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...