Compound Q&A

What are the physical and chemical properties of (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0)?

Answer

(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid
(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid is a crystalline solid with a molecular weight of approximately 241.23 g/mol. It is slightly soluble in water and has good solubility in organic solvents. Chemically, it is reactive towards bases and can undergo esterification and condensation reactions. The compound is stable under normal conditions but should be stored away from direct sunlight and moisture.

About

CAS No 50402-83-0
English Name (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid
Molecular Formula C12H10O4
Molecular Weight 218.21 g/mol
SMILES CC1=CC2=C(C=C1)C(=CC(=O)O2)CC(=O)O
InChIKey VDQLZKYCWITDPF-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0) typically synthesized?

(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid can be synthesized through the coupling of 7-methyl-2-ox...

Compound Q&A

What industries use (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0)?

(7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid (CAS: 50402-83-0)?

When handling (7-Methyl-2-oxo-2H-chromen-4-yl)acetic acid, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...