Compound Q&A

What precautions should be taken when handling 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7)?

Answer

3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid
When handling 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and lab coats. The compound should be handled in a well-ventilated fume hood to prevent inhalation. Spills should be cleaned up using appropriate absorbent materials, and the area should be rinsed with water. It is recommended to consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid
Molecular Formula C30H25NO4
Molecular Weight 463.53 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)C(CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35
InChIKey PEYWNXMITXNNRZ-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7)?

3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) is a w...

Compound Q&A

How is 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) typically synthesized?

3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) is syn...

Compound Q&A

What industries use 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7)?

3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) is pri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...