Compound Q&A

What are the physical and chemical properties of 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7)?

Answer

3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid
3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) is a white crystalline solid with a molecular weight of approximately 524.5 g/mol. It has a low solubility in water and good solubility in organic solvents like DMSO. It is known for its high reactivity in esterification and amide formation reactions. It exhibits good stability under normal conditions but can degrade under strong acidic or basic conditions.

About

English Name 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid
Molecular Formula C30H25NO4
Molecular Weight 463.53 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)C(CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35
InChIKey PEYWNXMITXNNRZ-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

How is 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) typically synthesized?

3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) is syn...

Compound Q&A

What industries use 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7)?

3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7) is pri...

Compound Q&A

What precautions should be taken when handling 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 269078-79-7)?

When handling 3-(4-Biphenylyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid (CAS: 26907...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...