Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

Answer

2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate
Handle with caution in a fume hood. Wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Do not ingest or inhale the compound. In the event of a spill, clean up with appropriate absorbent materials and dispose of according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate
Molecular Formula C23H39NO10
Molecular Weight 489.56 g/mol
SMILES O=C(OC(C)(C)C)CCOCCOCCOCCOCCOCCOCCN1C(C=CC1=O)=O
InChIKey CUCNCZLNASXRTC-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

The compound has a crystalline form and a high molecular weight due to its complex structure. It is ...

Compound Q&A

How is 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6) typically synthesized?

This compound can be synthesized through a multi-step process involving nucleophilic substitution an...

Compound Q&A

What industries use 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive mole...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...