Compound Q&A

What industries use 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

Answer

2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate
This compound is primarily used in the pharmaceutical industry for its potential as a bioactive molecule. It is also explored in the polymer industry for its special chemical properties, although its specific applications are limited. Research in the areas of sensors and semiconductors is ongoing due to its unique structural features.

About

English Name 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate
Molecular Formula C23H39NO10
Molecular Weight 489.56 g/mol
SMILES O=C(OC(C)(C)C)CCOCCOCCOCCOCCOCCOCCN1C(C=CC1=O)=O
InChIKey CUCNCZLNASXRTC-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

The compound has a crystalline form and a high molecular weight due to its complex structure. It is ...

Compound Q&A

How is 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6) typically synthesized?

This compound can be synthesized through a multi-step process involving nucleophilic substitution an...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

Handle with caution in a fume hood. Wear appropriate personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...