Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

Answer

2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate
The compound has a crystalline form and a high molecular weight due to its complex structure. It is moderately soluble in common organic solvents such as DMSO and ethanol. Chemically, it is stable under normal conditions but can degrade in acidic environments. Reactivity is low, with limited reactivity towards common organic reagents.

About

English Name 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate
Molecular Formula C23H39NO10
Molecular Weight 489.56 g/mol
SMILES O=C(OC(C)(C)C)CCOCCOCCOCCOCCOCCOCCN1C(C=CC1=O)=O
InChIKey CUCNCZLNASXRTC-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6) typically synthesized?

This compound can be synthesized through a multi-step process involving nucleophilic substitution an...

Compound Q&A

What industries use 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive mole...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate (CAS: 518044-37-6)?

Handle with caution in a fume hood. Wear appropriate personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...