Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

Answer

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate
When handling 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be handled carefully using appropriate absorbents. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions. This compound is not considered highly toxic, but care should still be taken to avoid inhalation or skin contact.

About

English Name 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate
Molecular Formula C12H22N2O3
Molecular Weight 242.32 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC2(C1)CCNC2
InChIKey VESCRSHLXRKQFF-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is a solid with...

Compound Q&A

How is 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) typically synthesized?

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is synthesized ...

Compound Q&A

What industries use 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is primarily us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...