Compound Q&A

What industries use 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

Answer

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate
2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor in the synthesis of various pharmaceutical compounds and can also be used in the development of new polymer materials. Additionally, it may find applications in the sensor and semiconductor industries due to its unique chemical properties.

About

English Name 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate
Molecular Formula C12H22N2O3
Molecular Weight 242.32 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC2(C1)CCNC2
InChIKey VESCRSHLXRKQFF-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is a solid with...

Compound Q&A

How is 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) typically synthesized?

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is synthesized ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

When handling 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...