Compound Q&A

How is 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) typically synthesized?

Answer

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate
2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is synthesized via a multi-step reaction involving the formation of a 2,9-diazaspiro[4.5]decane ring followed by esterification. Common methods include the use of acyl chlorides or anhydrides as the carboxylic acid derivative. The reaction is typically performed in the presence of a solvent such as dichloromethane and a catalytic amount of a base like triethylamine. The yield and selectivity are generally good, with high purity products obtained.

About

English Name 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate
Molecular Formula C12H22N2O3
Molecular Weight 242.32 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC2(C1)CCNC2
InChIKey VESCRSHLXRKQFF-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is a solid with...

Compound Q&A

What industries use 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1) is primarily us...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1)?

When handling 2-Methyl-2-propanyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS: 637039-01-1), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...