Compound Q&A

How is Angiotensinogen (1-14) (rat) (CAS: 110200-37-8) typically synthesized?

Answer

Angiotensinogen (1-14) (rat)
Angiotensinogen (1-14) (rat) is typically synthesized via solid-phase peptide synthesis. The process involves stepwise coupling of protected amino acids to a solid support, followed by cleavage from the support and purification. Commonly used protecting groups include Boc (t-butyloxycarbonyl) and Fmoc (fluorenylmethoxycarbonyl) with coupling reagents like HATU or PyBOP. The selectivity and yield are high due to the controlled environment of the synthesis reactor.

About

English Name Angiotensinogen (1-14) (rat)
Molecular Formula C89H123N21O21
Molecular Weight 1823.1 g/mol
SMILES CCC(C)C(C(=O)NC(CC1=CNC=N1)C(=O)N2CCCC2C(=O)NC(CC3=CC=CC=C3)C(=O)NC(CC4=CNC=N4)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC5=CC=C(C=C5)O)C(=O)NC(CC6=CC=C(C=C6)O)C(=O)NC(CO)C(=O)O)NC(=O)C(CC7=CC=C(C=C7)O)NC(=O)C(C(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(=O)O)N
InChIKey FFCYBSGRCYFCNM-YXRWNMRVSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Angiotensinogen (1-14) (rat) (CAS: 110200-37-8)?

Angiotensinogen (1-14) (rat) is a peptide with a molecular weight of approximately 1654.4 Da. It is ...

Compound Q&A

What industries use Angiotensinogen (1-14) (rat) (CAS: 110200-37-8)?

Angiotensinogen (1-14) (rat) is primarily used in the pharmaceutical industry for studying angiotens...

Compound Q&A

What precautions should be taken when handling Angiotensinogen (1-14) (rat) (CAS: 110200-37-8)?

Precautions when handling Angiotensinogen (1-14) (rat) include wearing personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...