Compound Q&A

What are the physical and chemical properties of Angiotensinogen (1-14) (rat) (CAS: 110200-37-8)?

Answer

Angiotensinogen (1-14) (rat)
Angiotensinogen (1-14) (rat) is a peptide with a molecular weight of approximately 1654.4 Da. It is a white to off-white crystalline powder with good solubility in water. Physically, it is stable at room temperature but may degrade under extreme pH conditions. Chemically, it is susceptible to proteolytic degradation and is reactive with various reagents.

About

English Name Angiotensinogen (1-14) (rat)
Molecular Formula C89H123N21O21
Molecular Weight 1823.1 g/mol
SMILES CCC(C)C(C(=O)NC(CC1=CNC=N1)C(=O)N2CCCC2C(=O)NC(CC3=CC=CC=C3)C(=O)NC(CC4=CNC=N4)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC5=CC=C(C=C5)O)C(=O)NC(CC6=CC=C(C=C6)O)C(=O)NC(CO)C(=O)O)NC(=O)C(CC7=CC=C(C=C7)O)NC(=O)C(C(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(=O)O)N
InChIKey FFCYBSGRCYFCNM-YXRWNMRVSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

How is Angiotensinogen (1-14) (rat) (CAS: 110200-37-8) typically synthesized?

Angiotensinogen (1-14) (rat) is typically synthesized via solid-phase peptide synthesis. The process...

Compound Q&A

What industries use Angiotensinogen (1-14) (rat) (CAS: 110200-37-8)?

Angiotensinogen (1-14) (rat) is primarily used in the pharmaceutical industry for studying angiotens...

Compound Q&A

What precautions should be taken when handling Angiotensinogen (1-14) (rat) (CAS: 110200-37-8)?

Precautions when handling Angiotensinogen (1-14) (rat) include wearing personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...