Compound Q&A

What precautions should be taken when handling 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2)?

Answer

5-Chloro-4-nitro-2-thiophenesulfonyl chloride
When handling 5-Chloro-4-nitro-2-thiophenesulfonyl chloride, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure to fumes. In case of a spill, it should be carefully cleaned up using appropriate absorbent materials, and the area should be well-ventilated. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 58457-24-2
English Name 5-Chloro-4-nitro-2-thiophenesulfonyl chloride
Molecular Formula C4HCl2NO4S2
Molecular Weight 262.1 g/mol
SMILES C1=C(SC(=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl
InChIKey SGHAHFHTASPNKN-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2)?

5-Chloro-4-nitro-2-thiophenesulfonyl chloride is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2) typically synthesized?

5-Chloro-4-nitro-2-thiophenesulfonyl chloride is usually synthesized via the chlorination of 5-nitro...

Compound Q&A

What industries use 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2)?

5-Chloro-4-nitro-2-thiophenesulfonyl chloride finds applications in the pharmaceutical industry for ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...