Compound Q&A

What industries use 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2)?

Answer

5-Chloro-4-nitro-2-thiophenesulfonyl chloride
5-Chloro-4-nitro-2-thiophenesulfonyl chloride finds applications in the pharmaceutical industry for the synthesis of drugs and intermediates. It is also used in the polymer industry for the modification of polymers and in the sensor industry for the development of sensitive detection devices. Additionally, it is utilized in semiconductor manufacturing for specific chemical treatments.

About

CAS No 58457-24-2
English Name 5-Chloro-4-nitro-2-thiophenesulfonyl chloride
Molecular Formula C4HCl2NO4S2
Molecular Weight 262.1 g/mol
SMILES C1=C(SC(=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl
InChIKey SGHAHFHTASPNKN-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2)?

5-Chloro-4-nitro-2-thiophenesulfonyl chloride is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2) typically synthesized?

5-Chloro-4-nitro-2-thiophenesulfonyl chloride is usually synthesized via the chlorination of 5-nitro...

Compound Q&A

What precautions should be taken when handling 5-Chloro-4-nitro-2-thiophenesulfonyl chloride (CAS: 58457-24-2)?

When handling 5-Chloro-4-nitro-2-thiophenesulfonyl chloride, it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...