Compound Q&A

How is 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) typically synthesized?

Answer

2-(2-Methoxy-5-nitrophenyl)acetic acid
2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) can be synthesized through a multi-step process involving the nitration of a methylated phenol followed by acetylation. Commonly, this involves the use of nitric acid and sulfuric acid as nitrating agents, and acetic anhydride as the acetylating agent. The process requires careful temperature control and the use of appropriate catalysts to ensure high selectivity and yield.

About

CAS No 51073-04-2
English Name 2-(2-Methoxy-5-nitrophenyl)acetic acid
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES COC1=C(C=C(C=C1)[N+](=O)[O-])CC(=O)O
InChIKey TZQZNDOEOCOJFS-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2)?

2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2)?

2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) is used in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2)?

When handling 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2), it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...