Compound Q&A

What are the physical and chemical properties of 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2)?

Answer

2-(2-Methoxy-5-nitrophenyl)acetic acid
2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) is a crystalline solid with a molecular weight of approximately 246.13 g/mol. It has a moderate solubility in water and is slightly soluble in common organic solvents. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is a weak acid due to the presence of the carboxylic acid group.

About

CAS No 51073-04-2
English Name 2-(2-Methoxy-5-nitrophenyl)acetic acid
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES COC1=C(C=C(C=C1)[N+](=O)[O-])CC(=O)O
InChIKey TZQZNDOEOCOJFS-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

How is 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) typically synthesized?

2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) can be synthesized through a multi-step pro...

Compound Q&A

What industries use 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2)?

2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2) is used in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2)?

When handling 2-(2-Methoxy-5-nitrophenyl)acetic acid (CAS: 51073-04-2), it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...