Compound Q&A

What industries use Azilsartan Impurity 42 (CAS: 139481-33-7)?

Answer

Azilsartan Impurity 42
Azilsartan Impurity 42 is primarily used in the pharmaceutical industry for quality control testing and impurity profiling in the production of azilsartan medoxomil, a drug used to treat hypertension. It is also of interest in research for its potential as an analytical standard and for studying the pharmacokinetics and pharmacodynamics of azilsartan.

About

English Name Azilsartan Impurity 42
Molecular Formula C23H17N3O3
Molecular Weight 372.42 g/mol
SMILES COC(=O)c1cccc2c1n(c(=O)[nH]2)Cc3ccc(cc3)c4ccccc4C#N
InChIKey UPXHAIJRSNBMBO-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azilsartan Impurity 42 (CAS: 139481-33-7)?

Azilsartan Impurity 42 is a crystalline solid with a molecular weight of approximately 367.37 g/mol....

Compound Q&A

How is Azilsartan Impurity 42 (CAS: 139481-33-7) typically synthesized?

Azilsartan Impurity 42 is typically synthesized through a multi-step process involving esterificatio...

Compound Q&A

What precautions should be taken when handling Azilsartan Impurity 42 (CAS: 139481-33-7)?

When handling Azilsartan Impurity 42, it is recommended to use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...