Compound Q&A

How is Azilsartan Impurity 42 (CAS: 139481-33-7) typically synthesized?

Answer

Azilsartan Impurity 42
Azilsartan Impurity 42 is typically synthesized through a multi-step process involving esterification and ring closure reactions. The synthesis involves the use of common organic solvents such as dichloromethane and acetic acid. The reaction is catalyzed by a strong acid like trifluoroacetic acid (TFA) and proceeds with good selectivity and yield. The final product is purified by recrystallization and chromatography.

About

English Name Azilsartan Impurity 42
Molecular Formula C23H17N3O3
Molecular Weight 372.42 g/mol
SMILES COC(=O)c1cccc2c1n(c(=O)[nH]2)Cc3ccc(cc3)c4ccccc4C#N
InChIKey UPXHAIJRSNBMBO-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azilsartan Impurity 42 (CAS: 139481-33-7)?

Azilsartan Impurity 42 is a crystalline solid with a molecular weight of approximately 367.37 g/mol....

Compound Q&A

What industries use Azilsartan Impurity 42 (CAS: 139481-33-7)?

Azilsartan Impurity 42 is primarily used in the pharmaceutical industry for quality control testing ...

Compound Q&A

What precautions should be taken when handling Azilsartan Impurity 42 (CAS: 139481-33-7)?

When handling Azilsartan Impurity 42, it is recommended to use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...