Compound Q&A

What are the physical and chemical properties of Azilsartan Impurity 42 (CAS: 139481-33-7)?

Answer

Azilsartan Impurity 42
Azilsartan Impurity 42 is a crystalline solid with a molecular weight of approximately 367.37 g/mol. It is slightly soluble in water and alcohol. This impurity shows limited reactivity under normal conditions but can undergo hydrolysis under acidic or basic conditions. It has a melting point around 130-135°C and a specific gravity of about 1.35 at 20°C.

About

English Name Azilsartan Impurity 42
Molecular Formula C23H17N3O3
Molecular Weight 372.42 g/mol
SMILES COC(=O)c1cccc2c1n(c(=O)[nH]2)Cc3ccc(cc3)c4ccccc4C#N
InChIKey UPXHAIJRSNBMBO-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

How is Azilsartan Impurity 42 (CAS: 139481-33-7) typically synthesized?

Azilsartan Impurity 42 is typically synthesized through a multi-step process involving esterificatio...

Compound Q&A

What industries use Azilsartan Impurity 42 (CAS: 139481-33-7)?

Azilsartan Impurity 42 is primarily used in the pharmaceutical industry for quality control testing ...

Compound Q&A

What precautions should be taken when handling Azilsartan Impurity 42 (CAS: 139481-33-7)?

When handling Azilsartan Impurity 42, it is recommended to use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...