Compound Q&A

What industries use ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5)?

Answer

ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate
Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5) is primarily used in the pharmaceutical and chemical industries. It serves as a valuable intermediate in the synthesis of various drugs and is also used in the development of sensors and materials due to its unique chemical properties.

About

English Name ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate
Molecular Formula C12H10FNO3
Molecular Weight 235.21 g/mol
SMILES CCOC(=O)c1cc(on1)c2ccc(F)cc2
InChIKey IYDBYHCVVNAFSM-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5)?

Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5) is a crystalline solid with a ...

Compound Q&A

How is ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5) typically synthesized?

Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate is typically synthesized via a multistep process ...

Compound Q&A

What precautions should be taken when handling ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5)?

When handling ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...