Compound Q&A

What are the physical and chemical properties of ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5)?

Answer

ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate
Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5) is a crystalline solid with a molecular weight of approximately 250.23 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetonitrile. This compound exhibits good stability under normal conditions but reacts readily with strong oxidizing agents. Its melting point is around 150-155°C.

About

English Name ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate
Molecular Formula C12H10FNO3
Molecular Weight 235.21 g/mol
SMILES CCOC(=O)c1cc(on1)c2ccc(F)cc2
InChIKey IYDBYHCVVNAFSM-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

How is ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5) typically synthesized?

Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate is typically synthesized via a multistep process ...

Compound Q&A

What industries use ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5)?

Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5)?

When handling ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS: 640291-92-5), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...