Compound Q&A

What industries use 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

Answer

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid
1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid is primarily used in the pharmaceutical industry for the synthesis of various drug candidates. It also finds applications in the polymer industry for the development of specific polymers, and in the sensor industry for the fabrication of highly sensitive sensors. Additionally, it can be used in the semiconductor industry for specific applications requiring precise chemical structures.

About

English Name 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid
Molecular Formula C13H13FO3
Molecular Weight 236.242 g/mol
SMILES OC(=O)C1(CCC(=O)CC1)c2ccccc2F
InChIKey ZSHLDJCZQFHYBA-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid is a crystalline compound with a molecular weight...

Compound Q&A

How is 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4) typically synthesized?

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid can be synthesized through a multistep process in...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

When handling 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid, it is important to wear appropriat...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...